C20H23NO3 — CID 174323041
3-[2-(7-methyl-4-oxospiro[2,3-dihydronaphthalene-1,1'-cyclopropane]-2-yl)ethyl]piperidine-2,6-dione (PubChem CID 174323041) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[2-(7-methyl-4-oxospiro[2,3-dihydronaphthalene-1,1'-cyclopropane]-2-yl)ethyl]piperidine-2,6-dione.
| Compound Name | 3-[2-(7-methyl-4-oxospiro[2,3-dihydronaphthalene-1,1'-cyclopropane]-2-yl)ethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174323041 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 3-[2-(7-methyl-4-oxospiro[2,3-dihydronaphthalene-1,1'-cyclopropane]-2-yl)ethyl]piperidine-2,6-dione |
| SMILES | Cc1ccc2c(c1)C1(CC1)C(CCC1CCC(=O)NC1=O)CC2=O |
| InChI | InChI=1S/C20H23NO3/c1-12-2-6-15-16(10-12)20(8-9-20)14(11-17(15)22)5-3-13-4-7-18(23)21-19(13)24/h2,6,10,13-14H,3-5,7-9,11H2,1H3,(H,21,23,24) |
| InChIKey | LOGWNEXMACNZPP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|