C31H46F2N2 — CID 174324510
(2Z,4E)-4-(1,1-difluoroethyl)-1-(3-ethenylcyclohexa-1,2-dien-1-yl)-7-[(3E)-3-hexylidenepiperidin-1-yl]-N-prop-1-en-2-ylhepta-2,4-dien-3-amine (PubChem CID 174324510) has the molecular formula C31H46F2N2 and a molecular weight of 484.72 g/mol. Its IUPAC name is (2Z,4E)-4-(1,1-difluoroethyl)-1-(3-ethenylcyclohexa-1,2-dien-1-yl)-7-[(3E)-3-hexylidenepiperidin-1-yl]-N-prop-1-en-2-ylhepta-2,4-dien-3-amine.
| Compound Name | (2Z,4E)-4-(1,1-difluoroethyl)-1-(3-ethenylcyclohexa-1,2-dien-1-yl)-7-[(3E)-3-hexylidenepiperidin-1-yl]-N-prop-1-en-2-ylhepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 174324510 |
| Molecular Formula | C31H46F2N2 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | (2Z,4E)-4-(1,1-difluoroethyl)-1-(3-ethenylcyclohexa-1,2-dien-1-yl)-7-[(3E)-3-hexylidenepiperidin-1-yl]-N-prop-1-en-2-ylhepta-2,4-dien-3-amine |
| SMILES | C=CC1=C=C(C/C=C(NC(=C)C)/C(=C\CCN2CCC/C(=C\CCCCC)C2)C(C)(F)F)CCC1 |
| InChI | InChI=1S/C31H46F2N2/c1-6-8-9-10-14-28-17-12-21-35(24-28)22-13-18-29(31(5,32)33)30(34-25(3)4)20-19-27-16-11-15-26(7-2)23-27/h7,14,18,20,34H,2-3,6,8-13,15-17,19,21-22,24H2,1,4-5H3/b28-14+,29-18+,30-20- |
| InChIKey | GKIBXYSUEPEHHA-FPNFKPQRSA-N |
| XLogP | 8.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|