C22H22FN4O7PS — CID 174325137
[2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl-[2-(3-formamidoanilino)-2-oxoacetyl]amino]methyl dihydrogen phosphate (PubChem CID 174325137) has the molecular formula C22H22FN4O7PS and a molecular weight of 536.48 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl-[2-(3-formamidoanilino)-2-oxoacetyl]amino]methyl dihydrogen phosphate.
| Compound Name | [2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl-[2-(3-formamidoanilino)-2-oxoacetyl]amino]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 174325137 |
| Molecular Formula | C22H22FN4O7PS |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | [2-[2-(4-fluorophenyl)-4-methyl-1,3-thiazol-5-yl]ethyl-[2-(3-formamidoanilino)-2-oxoacetyl]amino]methyl dihydrogen phosphate |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1CCN(COP(=O)(O)O)C(=O)C(=O)Nc1cccc(NC=O)c1 |
| InChI | InChI=1S/C22H22FN4O7PS/c1-14-19(36-21(25-14)15-5-7-16(23)8-6-15)9-10-27(13-34-35(31,32)33)22(30)20(29)26-18-4-2-3-17(11-18)24-12-28/h2-8,11-12H,9-10,13H2,1H3,(H,24,28)(H,26,29)(H2,31,32,33) |
| InChIKey | VTQHZLUYEJZOFH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|