About N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine
N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine (PubChem CID 174325537) has the molecular formula C19H32N2
and a molecular weight of 288.48 g/mol. Its IUPAC name is N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine.
Molecular Properties
| Compound Name | N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine |
| PubChem CID | 174325537 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine |
| SMILES | C=C1CCC(NCNCC(=C=CC)C=C(C)C)C(CC)C1 |
| InChI | InChI=1S/C19H32N2/c1-6-8-17(11-15(3)4)13-20-14-21-19-10-9-16(5)12-18(19)7-2/h6,11,18-21H,5,7,9-10,12-14H2,1-4H3 |
| InChIKey | GFTIMKQZYRLOOF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine?
The IUPAC name of N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine (CID 174325537) is N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine.
What is the SMILES notation for N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine?
The canonical SMILES for N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine is C=C1CCC(NCNCC(=C=CC)C=C(C)C)C(CC)C1.
What is the InChIKey of N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine?
The InChIKey is GFTIMKQZYRLOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2/c1-6-8-17(11-15(3)4)13-20-14-21-19-10-9-16(5)12-18(19)7-2/h6,11,18-21H,5,7,9-10,12-14H2,1-4H3.
What are the key properties of N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine?
N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine has a molecular weight of 288.48 g/mol, XLogP of 4.33, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-ethyl-4-methylidenecyclohexyl)-N-[2-(2-methylprop-1-enyl)penta-2,3-dienyl]methanediamine is sourced from PubChem (CID 174325537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).