C14H23N3O3S — CID 17432578
2-(diethylamino)-N-[4-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 17432578) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-(diethylamino)-N-[4-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[4-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17432578 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-(diethylamino)-N-[4-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)CC(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H23N3O3S/c1-5-17(6-2)11-14(18)15-12-7-9-13(10-8-12)21(19,20)16(3)4/h7-10H,5-6,11H2,1-4H3,(H,15,18) |
| InChIKey | ICDYNHFJEABSHW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |