C16H24ClNO3 — CID 174325893
1-chloro-3-methylbenzene;methyl 2-acetamido-2-methylpentanoate (PubChem CID 174325893) has the molecular formula C16H24ClNO3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 1-chloro-3-methylbenzene;methyl 2-acetamido-2-methylpentanoate.
| Compound Name | 1-chloro-3-methylbenzene;methyl 2-acetamido-2-methylpentanoate |
|---|---|
| PubChem CID | 174325893 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-chloro-3-methylbenzene;methyl 2-acetamido-2-methylpentanoate |
| SMILES | CCCC(C)(NC(C)=O)C(=O)OC.Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C9H17NO3.C7H7Cl/c1-5-6-9(3,8(12)13-4)10-7(2)11;1-6-3-2-4-7(8)5-6/h5-6H2,1-4H3,(H,10,11);2-5H,1H3 |
| InChIKey | UCUCHTVZHVQHJK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |