C12H23NO2 — CID 174326114
N-(3,4-dimethylpentan-2-yl)oxolane-2-carboxamide (PubChem CID 174326114) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(3,4-dimethylpentan-2-yl)oxolane-2-carboxamide.
| Compound Name | N-(3,4-dimethylpentan-2-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 174326114 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(3,4-dimethylpentan-2-yl)oxolane-2-carboxamide |
| SMILES | CC(C)C(C)C(C)NC(=O)C1CCCO1 |
| InChI | InChI=1S/C12H23NO2/c1-8(2)9(3)10(4)13-12(14)11-6-5-7-15-11/h8-11H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | JAOCPNTYWQPLKI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |