C12H19FN2 — CID 174326321
3-fluoro-6-[(6-methyl-1,2,3,4-tetrahydropyridin-3-yl)methyl]-1,2,3,4-tetrahydropyridine (PubChem CID 174326321) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-fluoro-6-[(6-methyl-1,2,3,4-tetrahydropyridin-3-yl)methyl]-1,2,3,4-tetrahydropyridine.
| Compound Name | 3-fluoro-6-[(6-methyl-1,2,3,4-tetrahydropyridin-3-yl)methyl]-1,2,3,4-tetrahydropyridine |
|---|---|
| PubChem CID | 174326321 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-fluoro-6-[(6-methyl-1,2,3,4-tetrahydropyridin-3-yl)methyl]-1,2,3,4-tetrahydropyridine |
| SMILES | CC1=CCC(CC2=CCC(F)CN2)CN1 |
| InChI | InChI=1S/C12H19FN2/c1-9-2-3-10(7-14-9)6-12-5-4-11(13)8-15-12/h2,5,10-11,14-15H,3-4,6-8H2,1H3 |
| InChIKey | NBAXPFFZYAXRQC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |