C13H10Cl2F3N3O3 — CID 174326333
[3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl] 2,2-dichloropropanoate (PubChem CID 174326333) has the molecular formula C13H10Cl2F3N3O3 and a molecular weight of 384.14 g/mol. Its IUPAC name is [3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl] 2,2-dichloropropanoate.
| Compound Name | [3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl] 2,2-dichloropropanoate |
|---|---|
| PubChem CID | 174326333 |
| Molecular Formula | C13H10Cl2F3N3O3 |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | [3-[4-(difluoromethyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]-4-fluorophenyl] 2,2-dichloropropanoate |
| SMILES | Cc1nn(-c2cc(OC(=O)C(C)(Cl)Cl)ccc2F)c(=O)n1C(F)F |
| InChI | InChI=1S/C13H10Cl2F3N3O3/c1-6-19-21(12(23)20(6)11(17)18)9-5-7(3-4-8(9)16)24-10(22)13(2,14)15/h3-5,11H,1-2H3 |
| InChIKey | FPXHARQPAYBLHR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|