About acetyloxy(phenyl)mercury;indigane;oxotin
acetyloxy(phenyl)mercury;indigane;oxotin (PubChem CID 174326371) has the molecular formula C8H11HgInO3Sn
and a molecular weight of 589.29 g/mol. Its IUPAC name is acetyloxy(phenyl)mercury;indigane;oxotin.
Molecular Properties
| Compound Name | acetyloxy(phenyl)mercury;indigane;oxotin |
| PubChem CID | 174326371 |
| Molecular Formula | C8H11HgInO3Sn |
| Molecular Weight | 589.29 g/mol |
| Exact Mass | 591.85 |
| IUPAC Name | acetyloxy(phenyl)mercury;indigane;oxotin |
| SMILES | CC(=O)O[Hg]c1ccccc1.O=[Sn].[InH3] |
| InChI | InChI=1S/C6H5.C2H4O2.Hg.In.O.Sn.3H/c1-2-4-6-5-3-1;1-2(3)4;;;;;;;/h1-5H;1H3,(H,3,4);;;;;;;/q;;+1;;;;;;/p-1 |
| InChIKey | AZSSIBXWZARXQC-UHFFFAOYSA-M |
| XLogP | -0.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 589.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetyloxy(phenyl)mercury;indigane;oxotin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxy(phenyl)mercury;indigane;oxotin?
The IUPAC name of acetyloxy(phenyl)mercury;indigane;oxotin (CID 174326371) is acetyloxy(phenyl)mercury;indigane;oxotin.
What is the SMILES notation for acetyloxy(phenyl)mercury;indigane;oxotin?
The canonical SMILES for acetyloxy(phenyl)mercury;indigane;oxotin is CC(=O)O[Hg]c1ccccc1.O=[Sn].[InH3].
What is the InChIKey of acetyloxy(phenyl)mercury;indigane;oxotin?
The InChIKey is AZSSIBXWZARXQC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.C2H4O2.Hg.In.O.Sn.3H/c1-2-4-6-5-3-1;1-2(3)4;;;;;;;/h1-5H;1H3,(H,3,4);;;;;;;/q;;+1;;;;;;/p-1.
What are the key properties of acetyloxy(phenyl)mercury;indigane;oxotin?
acetyloxy(phenyl)mercury;indigane;oxotin has a molecular weight of 589.29 g/mol, XLogP of -0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxy(phenyl)mercury;indigane;oxotin is sourced from PubChem (CID 174326371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).