About (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine
(5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine (PubChem CID 174326947) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine.
Molecular Properties
| Compound Name | (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine |
| PubChem CID | 174326947 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine |
| SMILES | C/C=C1/C=CC(N(C)C)=N/C1=N\C |
| InChI | InChI=1S/C10H15N3/c1-5-8-6-7-9(13(3)4)12-10(8)11-2/h5-7H,1-4H3/b8-5-,11-10- |
| InChIKey | FSOQAJSYWSLGBN-QDKPKGLSSA-N |
| XLogP | 1.49 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine?
The IUPAC name of (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine (CID 174326947) is (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine.
What is the SMILES notation for (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine?
The canonical SMILES for (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine is C/C=C1/C=CC(N(C)C)=N/C1=N\C.
What is the InChIKey of (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine?
The InChIKey is FSOQAJSYWSLGBN-QDKPKGLSSA-N. The full InChI is InChI=1S/C10H15N3/c1-5-8-6-7-9(13(3)4)12-10(8)11-2/h5-7H,1-4H3/b8-5-,11-10-.
What are the key properties of (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine?
(5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine has a molecular weight of 177.25 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-ethylidene-N,N-dimethyl-6-methyliminopyridin-2-amine is sourced from PubChem (CID 174326947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).