C49H37NO — CID 174327158
N-[(1Z,3E)-1-[3-(3-dibenzofuran-2-ylphenyl)-4-phenylphenyl]-3-phenylpenta-1,3-dienyl]-1-phenylethanimine (PubChem CID 174327158) has the molecular formula C49H37NO and a molecular weight of 655.84 g/mol. Its IUPAC name is N-[(1Z,3E)-1-[3-(3-dibenzofuran-2-ylphenyl)-4-phenylphenyl]-3-phenylpenta-1,3-dienyl]-1-phenylethanimine.
| Compound Name | N-[(1Z,3E)-1-[3-(3-dibenzofuran-2-ylphenyl)-4-phenylphenyl]-3-phenylpenta-1,3-dienyl]-1-phenylethanimine |
|---|---|
| PubChem CID | 174327158 |
| Molecular Formula | C49H37NO |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | N-[(1Z,3E)-1-[3-(3-dibenzofuran-2-ylphenyl)-4-phenylphenyl]-3-phenylpenta-1,3-dienyl]-1-phenylethanimine |
| SMILES | C/C=C(\C=C(/N=C(\C)c1ccccc1)c1ccc(-c2ccccc2)c(-c2cccc(-c3ccc4oc5ccccc5c4c3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C49H37NO/c1-3-35(37-18-9-5-10-19-37)33-47(50-34(2)36-16-7-4-8-17-36)42-26-28-43(38-20-11-6-12-21-38)45(32-42)41-23-15-22-39(30-41)40-27-29-49-46(31-40)44-24-13-14-25-48(44)51-49/h3-33H,1-2H3/b35-3+,47-33-,50-34+ |
| InChIKey | XNXJNCJIRSOVBI-NASSBABHSA-N |
| XLogP | 13.54 |
| TPSA | 25.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|