C18H25N — CID 174327281
2,5-bis[(1Z)-buta-1,3-dienyl]-N,N,1,3,4-pentamethylcyclopenta-2,4-dien-1-amine (PubChem CID 174327281) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is 2,5-bis[(1Z)-buta-1,3-dienyl]-N,N,1,3,4-pentamethylcyclopenta-2,4-dien-1-amine.
| Compound Name | 2,5-bis[(1Z)-buta-1,3-dienyl]-N,N,1,3,4-pentamethylcyclopenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 174327281 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | 2,5-bis[(1Z)-buta-1,3-dienyl]-N,N,1,3,4-pentamethylcyclopenta-2,4-dien-1-amine |
| SMILES | C=C/C=C\C1=C(C)C(C)=C(/C=C\C=C)C1(C)N(C)C |
| InChI | InChI=1S/C18H25N/c1-8-10-12-16-14(3)15(4)17(13-11-9-2)18(16,5)19(6)7/h8-13H,1-2H2,3-7H3/b12-10-,13-11- |
| InChIKey | WCBOAOBYGYFLCI-MIMPSMLTSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|