About (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate
(3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate (PubChem CID 174328051) has the molecular formula C15H18FN3O5S
and a molecular weight of 371.39 g/mol. Its IUPAC name is (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate.
Molecular Properties
| Compound Name | (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate |
| PubChem CID | 174328051 |
| Molecular Formula | C15H18FN3O5S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate |
| SMILES | CC(C)c1nc(COC(N)=O)n(C)c1S(=O)(=O)Oc1cccc(F)c1 |
| InChI | InChI=1S/C15H18FN3O5S/c1-9(2)13-14(19(3)12(18-13)8-23-15(17)20)25(21,22)24-11-6-4-5-10(16)7-11/h4-7,9H,8H2,1-3H3,(H2,17,20) |
| InChIKey | NLCAORQXUSDSKQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate?
The IUPAC name of (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate (CID 174328051) is (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate.
What is the SMILES notation for (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate?
The canonical SMILES for (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate is CC(C)c1nc(COC(N)=O)n(C)c1S(=O)(=O)Oc1cccc(F)c1.
What is the InChIKey of (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate?
The InChIKey is NLCAORQXUSDSKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3O5S/c1-9(2)13-14(19(3)12(18-13)8-23-15(17)20)25(21,22)24-11-6-4-5-10(16)7-11/h4-7,9H,8H2,1-3H3,(H2,17,20).
What are the key properties of (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate?
(3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate has a molecular weight of 371.39 g/mol, XLogP of 2.05, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) 2-(carbamoyloxymethyl)-3-methyl-5-propan-2-ylimidazole-4-sulfonate is sourced from PubChem (CID 174328051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).