C56H43NO — CID 174328117
(1Z,3E,5S)-1-[3-(2-methyl-5-spiro[fluorene-9,9'-xanthene]-2'-ylphenyl)phenyl]-3,5-diphenylhexa-1,3-dien-1-amine (PubChem CID 174328117) has the molecular formula C56H43NO and a molecular weight of 745.97 g/mol. Its IUPAC name is (1Z,3E,5S)-1-[3-(2-methyl-5-spiro[fluorene-9,9'-xanthene]-2'-ylphenyl)phenyl]-3,5-diphenylhexa-1,3-dien-1-amine.
| Compound Name | (1Z,3E,5S)-1-[3-(2-methyl-5-spiro[fluorene-9,9'-xanthene]-2'-ylphenyl)phenyl]-3,5-diphenylhexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 174328117 |
| Molecular Formula | C56H43NO |
| Molecular Weight | 745.97 g/mol |
| Exact Mass | 745.33 |
| IUPAC Name | (1Z,3E,5S)-1-[3-(2-methyl-5-spiro[fluorene-9,9'-xanthene]-2'-ylphenyl)phenyl]-3,5-diphenylhexa-1,3-dien-1-amine |
| SMILES | Cc1ccc(-c2ccc3c(c2)C2(c4ccccc4O3)c3ccccc3-c3ccccc32)cc1-c1cccc(/C(N)=C/C(=C\[C@H](C)c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C56H43NO/c1-37-28-29-41(34-48(37)43-20-15-21-44(33-43)53(57)36-45(40-18-7-4-8-19-40)32-38(2)39-16-5-3-6-17-39)42-30-31-55-52(35-42)56(51-26-13-14-27-54(51)58-55)49-24-11-9-22-46(49)47-23-10-12-25-50(47)56/h3-36,38H,57H2,1-2H3/b45-32+,53-36-/t38-/m0/s1 |
| InChIKey | NRRBRNQACPNOKD-IODCMGCDSA-N |
| XLogP | 13.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.97 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|