About N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide
N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide (PubChem CID 174328324) has the molecular formula C10H15F3N4
and a molecular weight of 248.25 g/mol. Its IUPAC name is N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide.
Molecular Properties
| Compound Name | N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide |
| PubChem CID | 174328324 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide |
| SMILES | C=N/C(=N\C=C(/C)C(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C10H15F3N4/c1-8(10(11,12)13)7-16-9(14-2)17-5-3-15-4-6-17/h7,15H,2-6H2,1H3/b8-7+,16-9+ |
| InChIKey | XUDMRKSXMDYAAH-BVQNTDGTSA-N |
| XLogP | 1.41 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide?
The IUPAC name of N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide (CID 174328324) is N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide.
What is the SMILES notation for N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide?
The canonical SMILES for N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide is C=N/C(=N\C=C(/C)C(F)(F)F)N1CCNCC1.
What is the InChIKey of N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide?
The InChIKey is XUDMRKSXMDYAAH-BVQNTDGTSA-N. The full InChI is InChI=1S/C10H15F3N4/c1-8(10(11,12)13)7-16-9(14-2)17-5-3-15-4-6-17/h7,15H,2-6H2,1H3/b8-7+,16-9+.
What are the key properties of N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide?
N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide has a molecular weight of 248.25 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylidene-N'-[(E)-3,3,3-trifluoro-2-methylprop-1-enyl]piperazine-1-carboximidamide is sourced from PubChem (CID 174328324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).