About (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate
(3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate (PubChem CID 174328648) has the molecular formula C16H20Cl2N2O4S
and a molecular weight of 407.32 g/mol. Its IUPAC name is (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate |
| PubChem CID | 174328648 |
| Molecular Formula | C16H20Cl2N2O4S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate |
| SMILES | CCn1c(CCO)nc(C(C)C)c1S(=O)(=O)Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O4S/c1-4-20-14(5-6-21)19-15(10(2)3)16(20)25(22,23)24-13-8-11(17)7-12(18)9-13/h7-10,21H,4-6H2,1-3H3 |
| InChIKey | XUSLCQMPXLVIIN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate?
The IUPAC name of (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate (CID 174328648) is (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate.
What is the SMILES notation for (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate?
The canonical SMILES for (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate is CCn1c(CCO)nc(C(C)C)c1S(=O)(=O)Oc1cc(Cl)cc(Cl)c1.
What is the InChIKey of (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate?
The InChIKey is XUSLCQMPXLVIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O4S/c1-4-20-14(5-6-21)19-15(10(2)3)16(20)25(22,23)24-13-8-11(17)7-12(18)9-13/h7-10,21H,4-6H2,1-3H3.
What are the key properties of (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate?
(3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate has a molecular weight of 407.32 g/mol, XLogP of 3.64, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl) 3-ethyl-2-(2-hydroxyethyl)-5-propan-2-ylimidazole-4-sulfonate is sourced from PubChem (CID 174328648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).