C20H27F2N3OS — CID 174329000
(2R)-1-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]pyrrolidine-2-carbothioamide (PubChem CID 174329000) has the molecular formula C20H27F2N3OS and a molecular weight of 395.52 g/mol. Its IUPAC name is (2R)-1-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]pyrrolidine-2-carbothioamide.
| Compound Name | (2R)-1-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]pyrrolidine-2-carbothioamide |
|---|---|
| PubChem CID | 174329000 |
| Molecular Formula | C20H27F2N3OS |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (2R)-1-[(3S,4R)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carbonyl]pyrrolidine-2-carbothioamide |
| SMILES | CC(C)(C)N1C[C@@H](C(=O)N2CCC[C@@H]2C(N)=S)[C@H](c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C20H27F2N3OS/c1-20(2,3)24-10-14(13-7-6-12(21)9-16(13)22)15(11-24)19(26)25-8-4-5-17(25)18(23)27/h6-7,9,14-15,17H,4-5,8,10-11H2,1-3H3,(H2,23,27)/t14-,15+,17+/m0/s1 |
| InChIKey | UDMSTLOLCYKLST-ZMSDIMECSA-N |
| XLogP | 3.06 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|