About 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine
6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine (PubChem CID 174329003) has the molecular formula C11H19F2N
and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine.
Molecular Properties
| Compound Name | 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine |
| PubChem CID | 174329003 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine |
| SMILES | C=C(CC(C)/C(=N/C)C(C)C)C(F)F |
| InChI | InChI=1S/C11H19F2N/c1-7(2)10(14-5)8(3)6-9(4)11(12)13/h7-8,11H,4,6H2,1-3,5H3/b14-10+ |
| InChIKey | GBSKEPVONKYRFL-GXDHUFHOSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine?
The IUPAC name of 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine (CID 174329003) is 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine.
What is the SMILES notation for 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine?
The canonical SMILES for 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine is C=C(CC(C)/C(=N/C)C(C)C)C(F)F.
What is the InChIKey of 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine?
The InChIKey is GBSKEPVONKYRFL-GXDHUFHOSA-N. The full InChI is InChI=1S/C11H19F2N/c1-7(2)10(14-5)8(3)6-9(4)11(12)13/h7-8,11H,4,6H2,1-3,5H3/b14-10+.
What are the key properties of 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine?
6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine has a molecular weight of 203.28 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-N,2,4-trimethylhept-6-en-3-imine is sourced from PubChem (CID 174329003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).