C7H3F3N2S — CID 174329635
5-(2,4-difluorothiophen-3-yl)-4-fluoro-1H-pyrazole (PubChem CID 174329635) has the molecular formula C7H3F3N2S and a molecular weight of 204.18 g/mol. Its IUPAC name is 5-(2,4-difluorothiophen-3-yl)-4-fluoro-1H-pyrazole.
| Compound Name | 5-(2,4-difluorothiophen-3-yl)-4-fluoro-1H-pyrazole |
|---|---|
| PubChem CID | 174329635 |
| Molecular Formula | C7H3F3N2S |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 5-(2,4-difluorothiophen-3-yl)-4-fluoro-1H-pyrazole |
| SMILES | Fc1cn[nH]c1-c1c(F)csc1F |
| InChI | InChI=1S/C7H3F3N2S/c8-3-1-11-12-6(3)5-4(9)2-13-7(5)10/h1-2H,(H,11,12) |
| InChIKey | XAMRGYUPCKGQGR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |