About ethyl N-propan-2-ylcarbamate
ethyl N-propan-2-ylcarbamate (PubChem CID 17433) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is ethyl N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | ethyl N-propan-2-ylcarbamate |
| PubChem CID | 17433 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | ethyl N-propan-2-ylcarbamate |
| SMILES | CCOC(=O)NC(C)C |
| InChI | InChI=1S/C6H13NO2/c1-4-9-6(8)7-5(2)3/h5H,4H2,1-3H3,(H,7,8) |
| InChIKey | JGRPZAGOYKNIAC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-propan-2-ylcarbamate?
The IUPAC name of ethyl N-propan-2-ylcarbamate (CID 17433) is ethyl N-propan-2-ylcarbamate.
What is the SMILES notation for ethyl N-propan-2-ylcarbamate?
The canonical SMILES for ethyl N-propan-2-ylcarbamate is CCOC(=O)NC(C)C.
What is the InChIKey of ethyl N-propan-2-ylcarbamate?
The InChIKey is JGRPZAGOYKNIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-4-9-6(8)7-5(2)3/h5H,4H2,1-3H3,(H,7,8).
What are the key properties of ethyl N-propan-2-ylcarbamate?
ethyl N-propan-2-ylcarbamate has a molecular weight of 131.18 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-propan-2-ylcarbamate is sourced from PubChem (CID 17433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).