C34H47N — CID 174330008
N-methyl-4-[(3E)-13-methyl-17-prop-1-en-2-yl-3-propylidene-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]-N-propan-2-ylaniline (PubChem CID 174330008) has the molecular formula C34H47N and a molecular weight of 469.76 g/mol. Its IUPAC name is N-methyl-4-[(3E)-13-methyl-17-prop-1-en-2-yl-3-propylidene-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]-N-propan-2-ylaniline.
| Compound Name | N-methyl-4-[(3E)-13-methyl-17-prop-1-en-2-yl-3-propylidene-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 174330008 |
| Molecular Formula | C34H47N |
| Molecular Weight | 469.76 g/mol |
| Exact Mass | 469.37 |
| IUPAC Name | N-methyl-4-[(3E)-13-methyl-17-prop-1-en-2-yl-3-propylidene-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]-N-propan-2-ylaniline |
| SMILES | C=C(C)C1CCC2C3CCC4=C/C(=C/CC)CCC4=C3C(c3ccc(N(C)C(C)C)cc3)CC12C |
| InChI | InChI=1S/C34H47N/c1-8-9-24-10-16-28-26(20-24)13-17-29-32-19-18-31(22(2)3)34(32,6)21-30(33(28)29)25-11-14-27(15-12-25)35(7)23(4)5/h9,11-12,14-15,20,23,29-32H,2,8,10,13,16-19,21H2,1,3-7H3/b24-9+ |
| InChIKey | KGXKQVHREHMOML-PGGKNCGUSA-N |
| XLogP | 9.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.76 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|