About cesium;hydride;phosphanylsulfonyloxybenzene
cesium;hydride;phosphanylsulfonyloxybenzene (PubChem CID 174330108) has the molecular formula C6H8CsO3PS
and a molecular weight of 324.07 g/mol. Its IUPAC name is cesium;hydride;phosphanylsulfonyloxybenzene.
Molecular Properties
| Compound Name | cesium;hydride;phosphanylsulfonyloxybenzene |
| PubChem CID | 174330108 |
| Molecular Formula | C6H8CsO3PS |
| Molecular Weight | 324.07 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | cesium;hydride;phosphanylsulfonyloxybenzene |
| SMILES | O=S(=O)(P)Oc1ccccc1.[Cs+].[H-] |
| InChI | InChI=1S/C6H7O3PS.Cs.H/c7-11(8,10)9-6-4-2-1-3-5-6;;/h1-5H,10H2;;/q;+1;-1 |
| InChIKey | NYEBHRFLAJWTPQ-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.07 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cesium;hydride;phosphanylsulfonyloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;hydride;phosphanylsulfonyloxybenzene?
The IUPAC name of cesium;hydride;phosphanylsulfonyloxybenzene (CID 174330108) is cesium;hydride;phosphanylsulfonyloxybenzene.
What is the SMILES notation for cesium;hydride;phosphanylsulfonyloxybenzene?
The canonical SMILES for cesium;hydride;phosphanylsulfonyloxybenzene is O=S(=O)(P)Oc1ccccc1.[Cs+].[H-].
What is the InChIKey of cesium;hydride;phosphanylsulfonyloxybenzene?
The InChIKey is NYEBHRFLAJWTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O3PS.Cs.H/c7-11(8,10)9-6-4-2-1-3-5-6;;/h1-5H,10H2;;/q;+1;-1.
What are the key properties of cesium;hydride;phosphanylsulfonyloxybenzene?
cesium;hydride;phosphanylsulfonyloxybenzene has a molecular weight of 324.07 g/mol, XLogP of -1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;hydride;phosphanylsulfonyloxybenzene is sourced from PubChem (CID 174330108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).