C17H37N3O2 — CID 174330194
4-amino-6-[1-[4-(dimethylamino)butyl]piperidin-4-yl]hexane-1,4-diol (PubChem CID 174330194) has the molecular formula C17H37N3O2 and a molecular weight of 315.50 g/mol. Its IUPAC name is 4-amino-6-[1-[4-(dimethylamino)butyl]piperidin-4-yl]hexane-1,4-diol.
| Compound Name | 4-amino-6-[1-[4-(dimethylamino)butyl]piperidin-4-yl]hexane-1,4-diol |
|---|---|
| PubChem CID | 174330194 |
| Molecular Formula | C17H37N3O2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | 4-amino-6-[1-[4-(dimethylamino)butyl]piperidin-4-yl]hexane-1,4-diol |
| SMILES | CN(C)CCCCN1CCC(CCC(N)(O)CCCO)CC1 |
| InChI | InChI=1S/C17H37N3O2/c1-19(2)11-3-4-12-20-13-7-16(8-14-20)6-10-17(18,22)9-5-15-21/h16,21-22H,3-15,18H2,1-2H3 |
| InChIKey | YIMFMCWXHQSBCI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|