C28H46N2 — CID 174330256
4-[7-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-yl]cyclododecyl]piperidine (PubChem CID 174330256) has the molecular formula C28H46N2 and a molecular weight of 410.69 g/mol. Its IUPAC name is 4-[7-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-yl]cyclododecyl]piperidine.
| Compound Name | 4-[7-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-yl]cyclododecyl]piperidine |
|---|---|
| PubChem CID | 174330256 |
| Molecular Formula | C28H46N2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.37 |
| IUPAC Name | 4-[7-[3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-3,4-dihydro-2H-pyrrol-5-yl]cyclododecyl]piperidine |
| SMILES | C=C(/C=C\C=C/C)C1CN=C(C2CCCCCC(C3CCNCC3)CCCCC2)C1 |
| InChI | InChI=1S/C28H46N2/c1-3-4-7-12-23(2)27-21-28(30-22-27)26-15-10-5-8-13-24(14-9-6-11-16-26)25-17-19-29-20-18-25/h3-4,7,12,24-27,29H,2,5-6,8-11,13-22H2,1H3/b4-3-,12-7- |
| InChIKey | HMAGGJCDFMJMAB-DQXWCLFKSA-N |
| XLogP | 7.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|