About N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate
N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate (PubChem CID 174330342) has the molecular formula C19H23N3O2S
and a molecular weight of 357.48 g/mol. Its IUPAC name is N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate.
Molecular Properties
| Compound Name | N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate |
| PubChem CID | 174330342 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate |
| SMILES | CN(C)c1ccnc2ncccc12.COC(=O)C(C)(C)c1cccs1 |
| InChI | InChI=1S/C10H11N3.C9H12O2S/c1-13(2)9-5-7-12-10-8(9)4-3-6-11-10;1-9(2,8(10)11-3)7-5-4-6-12-7/h3-7H,1-2H3;4-6H,1-3H3 |
| InChIKey | VTHRHHRBSJYHOT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate?
The IUPAC name of N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate (CID 174330342) is N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate.
What is the SMILES notation for N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate?
The canonical SMILES for N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate is CN(C)c1ccnc2ncccc12.COC(=O)C(C)(C)c1cccs1.
What is the InChIKey of N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate?
The InChIKey is VTHRHHRBSJYHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3.C9H12O2S/c1-13(2)9-5-7-12-10-8(9)4-3-6-11-10;1-9(2,8(10)11-3)7-5-4-6-12-7/h3-7H,1-2H3;4-6H,1-3H3.
What are the key properties of N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate?
N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate has a molecular weight of 357.48 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,8-naphthyridin-4-amine;methyl 2-methyl-2-thiophen-2-ylpropanoate is sourced from PubChem (CID 174330342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).