C18H24N4O3 — CID 17433076
[1-(2,6-dimethylmorpholin-4-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]urea (PubChem CID 17433076) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is [1-(2,6-dimethylmorpholin-4-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]urea.
| Compound Name | [1-(2,6-dimethylmorpholin-4-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 17433076 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [1-(2,6-dimethylmorpholin-4-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]urea |
| SMILES | CC1CN(C(=O)C(Cc2c[nH]c3ccccc23)NC(N)=O)CC(C)O1 |
| InChI | InChI=1S/C18H24N4O3/c1-11-9-22(10-12(2)25-11)17(23)16(21-18(19)24)7-13-8-20-15-6-4-3-5-14(13)15/h3-6,8,11-12,16,20H,7,9-10H2,1-2H3,(H3,19,21,24) |
| InChIKey | GAFZTIXFGFXQAK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |