About N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine
N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 174331578) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 174331578 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCCC(CCC)CCNC1=NCCN1 |
| InChI | InChI=1S/C12H25N3/c1-3-5-11(6-4-2)7-8-13-12-14-9-10-15-12/h11H,3-10H2,1-2H3,(H2,13,14,15) |
| InChIKey | BPWDJEDJNPTZIH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine (CID 174331578) is N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine is CCCC(CCC)CCNC1=NCCN1.
What is the InChIKey of N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is BPWDJEDJNPTZIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-3-5-11(6-4-2)7-8-13-12-14-9-10-15-12/h11H,3-10H2,1-2H3,(H2,13,14,15).
What are the key properties of N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine?
N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 211.35 g/mol, XLogP of 2.14, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-propylhexyl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 174331578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).