C13H25N3 — CID 174331925
(3aS,6aR)-5-methyl-2-(4-methylpiperazin-1-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 174331925) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is (3aS,6aR)-5-methyl-2-(4-methylpiperazin-1-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,6aR)-5-methyl-2-(4-methylpiperazin-1-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 174331925 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | (3aS,6aR)-5-methyl-2-(4-methylpiperazin-1-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CC1C[C@@H]2CN(N3CCN(C)CC3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H25N3/c1-11-7-12-9-16(10-13(12)8-11)15-5-3-14(2)4-6-15/h11-13H,3-10H2,1-2H3/t11?,12-,13+ |
| InChIKey | CMJODEHPVDAYOX-YHWZYXNKSA-N |
| XLogP | 1.13 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |