C8H14O — CID 174332072
(2R)-2,5-dimethyl-2,3,6,7-tetrahydrooxepine (PubChem CID 174332072) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2R)-2,5-dimethyl-2,3,6,7-tetrahydrooxepine.
| Compound Name | (2R)-2,5-dimethyl-2,3,6,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 174332072 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2R)-2,5-dimethyl-2,3,6,7-tetrahydrooxepine |
| SMILES | CC1=CC[C@@H](C)OCC1 |
| InChI | InChI=1S/C8H14O/c1-7-3-4-8(2)9-6-5-7/h3,8H,4-6H2,1-2H3/t8-/m1/s1 |
| InChIKey | SJBKPZAPMRCIRL-MRVPVSSYSA-N |
| XLogP | 2.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|