About 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine
4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine (PubChem CID 174332298) has the molecular formula C8H13N5
and a molecular weight of 179.23 g/mol. Its IUPAC name is 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine |
| PubChem CID | 174332298 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine |
| SMILES | [H]/N=c1/c(N)c(N(C)C=C)ncn1C |
| InChI | InChI=1S/C8H13N5/c1-4-12(2)8-6(9)7(10)13(3)5-11-8/h4-5,10H,1,9H2,2-3H3/b10-7- |
| InChIKey | MMZBVJIJWUWQRI-YFHOEESVSA-N |
| XLogP | 0.06 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine?
The IUPAC name of 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine (CID 174332298) is 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine.
What is the SMILES notation for 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine?
The canonical SMILES for 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine is [H]/N=c1/c(N)c(N(C)C=C)ncn1C.
What is the InChIKey of 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine?
The InChIKey is MMZBVJIJWUWQRI-YFHOEESVSA-N. The full InChI is InChI=1S/C8H13N5/c1-4-12(2)8-6(9)7(10)13(3)5-11-8/h4-5,10H,1,9H2,2-3H3/b10-7-.
What are the key properties of 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine?
4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine has a molecular weight of 179.23 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-ethenyl-6-imino-4-N,1-dimethylpyrimidine-4,5-diamine is sourced from PubChem (CID 174332298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).