C10H17B — CID 174332555
1,2,3,5,6-pentamethyl-4H-borinine (PubChem CID 174332555) has the molecular formula C10H17B and a molecular weight of 148.06 g/mol. Its IUPAC name is 1,2,3,5,6-pentamethyl-4H-borinine.
| Compound Name | 1,2,3,5,6-pentamethyl-4H-borinine |
|---|---|
| PubChem CID | 174332555 |
| Molecular Formula | C10H17B |
| Molecular Weight | 148.06 g/mol |
| Exact Mass | 148.14 |
| IUPAC Name | 1,2,3,5,6-pentamethyl-4H-borinine |
| SMILES | CB1C(C)=C(C)CC(C)=C1C |
| InChI | InChI=1S/C10H17B/c1-7-6-8(2)10(4)11(5)9(7)3/h6H2,1-5H3 |
| InChIKey | XVEIJTIIBGFJKT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.06 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|