About (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide
(1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide (PubChem CID 174332733) has the molecular formula C7H10BrNO2
and a molecular weight of 220.07 g/mol. Its IUPAC name is (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide.
Molecular Properties
| Compound Name | (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide |
| PubChem CID | 174332733 |
| Molecular Formula | C7H10BrNO2 |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide |
| SMILES | Br.CN1C=CC=CC1=C=O.O |
| InChI | InChI=1S/C7H7NO.BrH.H2O/c1-8-5-3-2-4-7(8)6-9;;/h2-5H,1H3;1H;1H2 |
| InChIKey | QOXYLRPFOQGOQZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide?
The IUPAC name of (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide (CID 174332733) is (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide.
What is the SMILES notation for (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide?
The canonical SMILES for (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide is Br.CN1C=CC=CC1=C=O.O.
What is the InChIKey of (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide?
The InChIKey is QOXYLRPFOQGOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.BrH.H2O/c1-8-5-3-2-4-7(8)6-9;;/h2-5H,1H3;1H;1H2.
What are the key properties of (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide?
(1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide has a molecular weight of 220.07 g/mol, XLogP of 0.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-2-pyridinylidene)methanone;hydrate;hydrobromide is sourced from PubChem (CID 174332733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).