C45H29N3O — CID 174332746
5-[1-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]-2-phenyl-1,3-benzoxazole (PubChem CID 174332746) has the molecular formula C45H29N3O and a molecular weight of 627.75 g/mol. Its IUPAC name is 5-[1-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]-2-phenyl-1,3-benzoxazole.
| Compound Name | 5-[1-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 174332746 |
| Molecular Formula | C45H29N3O |
| Molecular Weight | 627.75 g/mol |
| Exact Mass | 627.23 |
| IUPAC Name | 5-[1-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]naphthalen-2-yl]-2-phenyl-1,3-benzoxazole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4c(-c5ccc6oc(-c7ccccc7)nc6c5)ccc5ccccc45)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C45H29N3O/c1-4-13-31(14-5-1)39-29-40(47-44(46-39)34-15-6-2-7-16-34)32-20-22-33(23-21-32)43-37-19-11-10-12-30(37)24-26-38(43)36-25-27-42-41(28-36)48-45(49-42)35-17-8-3-9-18-35/h1-29H |
| InChIKey | CEIDYTWKGYCPDP-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.75 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |