C35H42ClFO — CID 174332767
1-[(Z)-4-[4-chloro-2-methyl-3-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]phenyl]-5-methylhept-4-enoxy]-6-fluoronaphthalene (PubChem CID 174332767) has the molecular formula C35H42ClFO and a molecular weight of 533.17 g/mol. Its IUPAC name is 1-[(Z)-4-[4-chloro-2-methyl-3-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]phenyl]-5-methylhept-4-enoxy]-6-fluoronaphthalene.
| Compound Name | 1-[(Z)-4-[4-chloro-2-methyl-3-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]phenyl]-5-methylhept-4-enoxy]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 174332767 |
| Molecular Formula | C35H42ClFO |
| Molecular Weight | 533.17 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | 1-[(Z)-4-[4-chloro-2-methyl-3-[(2Z,4E)-3,5,6-trimethylhepta-2,4-dien-4-yl]phenyl]-5-methylhept-4-enoxy]-6-fluoronaphthalene |
| SMILES | C/C=C(C)\C(=C(\C)C(C)C)c1c(Cl)ccc(/C(CCCOc2cccc3cc(F)ccc23)=C(/C)CC)c1C |
| InChI | InChI=1S/C35H42ClFO/c1-9-23(5)29(14-12-20-38-33-15-11-13-27-21-28(37)16-17-31(27)33)30-18-19-32(36)35(26(30)8)34(24(6)10-2)25(7)22(3)4/h10-11,13,15-19,21-22H,9,12,14,20H2,1-8H3/b24-10-,29-23-,34-25+ |
| InChIKey | YPMSIIGFNGMZSQ-RTAKDFLQSA-N |
| XLogP | 11.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.17 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|