C8H17N3 — CID 174333985
6-imino-1,2,4-trimethylpiperidin-3-amine (PubChem CID 174333985) has the molecular formula C8H17N3 and a molecular weight of 155.25 g/mol. Its IUPAC name is 6-imino-1,2,4-trimethylpiperidin-3-amine.
| Compound Name | 6-imino-1,2,4-trimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 174333985 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 6-imino-1,2,4-trimethylpiperidin-3-amine |
| SMILES | [H]/N=C1\CC(C)C(N)C(C)N1C |
| InChI | InChI=1S/C8H17N3/c1-5-4-7(9)11(3)6(2)8(5)10/h5-6,8-9H,4,10H2,1-3H3/b9-7+ |
| InChIKey | ILQBBDJHDIGUOY-VQHVLOKHSA-N |
| XLogP | 0.65 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|