C12H18N4 — CID 174334245
1,2,6-trimethyl-7-propylimidazo[4,5-c]pyridin-4-amine (PubChem CID 174334245) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1,2,6-trimethyl-7-propylimidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1,2,6-trimethyl-7-propylimidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 174334245 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1,2,6-trimethyl-7-propylimidazo[4,5-c]pyridin-4-amine |
| SMILES | CCCc1c(C)nc(N)c2nc(C)n(C)c12 |
| InChI | InChI=1S/C12H18N4/c1-5-6-9-7(2)14-12(13)10-11(9)16(4)8(3)15-10/h5-6H2,1-4H3,(H2,13,14) |
| InChIKey | ZWPLQLVFNHMCQE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |