About 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one
1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one (PubChem CID 174334866) has the molecular formula C14H22N4OS
and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one |
| PubChem CID | 174334866 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one |
| SMILES | Cc1csc(N2CCCN(CC3CCNCC3)C2=O)n1 |
| InChI | InChI=1S/C14H22N4OS/c1-11-10-20-13(16-11)18-8-2-7-17(14(18)19)9-12-3-5-15-6-4-12/h10,12,15H,2-9H2,1H3 |
| InChIKey | CLAGMJJDYALXRG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one?
The IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one (CID 174334866) is 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one is Cc1csc(N2CCCN(CC3CCNCC3)C2=O)n1.
What is the InChIKey of 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one?
The InChIKey is CLAGMJJDYALXRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4OS/c1-11-10-20-13(16-11)18-8-2-7-17(14(18)19)9-12-3-5-15-6-4-12/h10,12,15H,2-9H2,1H3.
What are the key properties of 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one?
1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one has a molecular weight of 294.42 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,3-thiazol-2-yl)-3-(piperidin-4-ylmethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 174334866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).