C13H15NO3S — CID 174335075
methyl 3-(3-formyl-2,3-dihydrothieno[2,3-b]pyridin-2-yl)-2-methylpropanoate (PubChem CID 174335075) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is methyl 3-(3-formyl-2,3-dihydrothieno[2,3-b]pyridin-2-yl)-2-methylpropanoate.
| Compound Name | methyl 3-(3-formyl-2,3-dihydrothieno[2,3-b]pyridin-2-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 174335075 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl 3-(3-formyl-2,3-dihydrothieno[2,3-b]pyridin-2-yl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)CC1Sc2ncccc2C1C=O |
| InChI | InChI=1S/C13H15NO3S/c1-8(13(16)17-2)6-11-10(7-15)9-4-3-5-14-12(9)18-11/h3-5,7-8,10-11H,6H2,1-2H3 |
| InChIKey | YTRYMSHEQWZNPM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|