C26H21NO2 — CID 174335339
1-[3-(2-propan-2-yl-1,3-benzoxazol-6-yl)phenyl]naphthalen-2-ol (PubChem CID 174335339) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-[3-(2-propan-2-yl-1,3-benzoxazol-6-yl)phenyl]naphthalen-2-ol.
| Compound Name | 1-[3-(2-propan-2-yl-1,3-benzoxazol-6-yl)phenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 174335339 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[3-(2-propan-2-yl-1,3-benzoxazol-6-yl)phenyl]naphthalen-2-ol |
| SMILES | CC(C)c1nc2ccc(-c3cccc(-c4c(O)ccc5ccccc45)c3)cc2o1 |
| InChI | InChI=1S/C26H21NO2/c1-16(2)26-27-22-12-10-19(15-24(22)29-26)18-7-5-8-20(14-18)25-21-9-4-3-6-17(21)11-13-23(25)28/h3-16,28H,1-2H3 |
| InChIKey | HONWTGJPBFTZCZ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |