About 3-hydroxypropanal;quinoline
3-hydroxypropanal;quinoline (PubChem CID 174335574) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-hydroxypropanal;quinoline.
Molecular Properties
| Compound Name | 3-hydroxypropanal;quinoline |
| PubChem CID | 174335574 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-hydroxypropanal;quinoline |
| SMILES | O=CCCO.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C3H6O2/c1-2-6-9-8(4-1)5-3-7-10-9;4-2-1-3-5/h1-7H;2,5H,1,3H2 |
| InChIKey | JOPKOBVGGVSSGN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropanal;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropanal;quinoline?
The IUPAC name of 3-hydroxypropanal;quinoline (CID 174335574) is 3-hydroxypropanal;quinoline.
What is the SMILES notation for 3-hydroxypropanal;quinoline?
The canonical SMILES for 3-hydroxypropanal;quinoline is O=CCCO.c1ccc2ncccc2c1.
What is the InChIKey of 3-hydroxypropanal;quinoline?
The InChIKey is JOPKOBVGGVSSGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H6O2/c1-2-6-9-8(4-1)5-3-7-10-9;4-2-1-3-5/h1-7H;2,5H,1,3H2.
What are the key properties of 3-hydroxypropanal;quinoline?
3-hydroxypropanal;quinoline has a molecular weight of 203.24 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropanal;quinoline is sourced from PubChem (CID 174335574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).