C8H13N3O2S2 — CID 174336672
3-acetyl-2,3,6,7,8,9-hexahydrothiadiazolo[2,3-b][1,2,3,6]thiatriazocin-5-one (PubChem CID 174336672) has the molecular formula C8H13N3O2S2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-acetyl-2,3,6,7,8,9-hexahydrothiadiazolo[2,3-b][1,2,3,6]thiatriazocin-5-one.
| Compound Name | 3-acetyl-2,3,6,7,8,9-hexahydrothiadiazolo[2,3-b][1,2,3,6]thiatriazocin-5-one |
|---|---|
| PubChem CID | 174336672 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3-acetyl-2,3,6,7,8,9-hexahydrothiadiazolo[2,3-b][1,2,3,6]thiatriazocin-5-one |
| SMILES | CC(=O)C1CSN2SCCNCC(=O)N12 |
| InChI | InChI=1S/C8H13N3O2S2/c1-6(12)7-5-15-11-10(7)8(13)4-9-2-3-14-11/h7,9H,2-5H2,1H3 |
| InChIKey | RVFFAFQESVDLOL-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|