C24H24N2O4S — CID 17433674
2-(4-acetyl-N-(4-methylphenyl)sulfonylanilino)-N-benzylacetamide (PubChem CID 17433674) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-(4-acetyl-N-(4-methylphenyl)sulfonylanilino)-N-benzylacetamide.
| Compound Name | 2-(4-acetyl-N-(4-methylphenyl)sulfonylanilino)-N-benzylacetamide |
|---|---|
| PubChem CID | 17433674 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-(4-acetyl-N-(4-methylphenyl)sulfonylanilino)-N-benzylacetamide |
| SMILES | CC(=O)c1ccc(N(CC(=O)NCc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-18-8-14-23(15-9-18)31(29,30)26(22-12-10-21(11-13-22)19(2)27)17-24(28)25-16-20-6-4-3-5-7-20/h3-15H,16-17H2,1-2H3,(H,25,28) |
| InChIKey | JNLGDRJFYZQSPI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |