About (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine
(3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine (PubChem CID 174337087) has the molecular formula C11H14F2N2
and a molecular weight of 212.24 g/mol. Its IUPAC name is (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine |
| PubChem CID | 174337087 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine |
| SMILES | [H]/N=C/C(=C)/C=C(/F)NC(=C)/C(F)=C\CC |
| InChI | InChI=1S/C11H14F2N2/c1-4-5-10(12)9(3)15-11(13)6-8(2)7-14/h5-7,14-15H,2-4H2,1H3/b10-5+,11-6-,14-7+ |
| InChIKey | LAMSLBXFIKQRJR-NTSYAQQNSA-N |
| XLogP | 3.37 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine?
The IUPAC name of (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine (CID 174337087) is (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine.
What is the SMILES notation for (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine?
The canonical SMILES for (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine is [H]/N=C/C(=C)/C=C(/F)NC(=C)/C(F)=C\CC.
What is the InChIKey of (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine?
The InChIKey is LAMSLBXFIKQRJR-NTSYAQQNSA-N. The full InChI is InChI=1S/C11H14F2N2/c1-4-5-10(12)9(3)15-11(13)6-8(2)7-14/h5-7,14-15H,2-4H2,1H3/b10-5+,11-6-,14-7+.
What are the key properties of (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine?
(3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine has a molecular weight of 212.24 g/mol, XLogP of 3.37, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-fluoro-N-[(1E)-1-fluoro-3-methanimidoylbuta-1,3-dienyl]hexa-1,3-dien-2-amine is sourced from PubChem (CID 174337087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).