About (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate
(3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate (PubChem CID 174338130) has the molecular formula C16H19F2N3O5S
and a molecular weight of 403.41 g/mol. Its IUPAC name is (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate.
Molecular Properties
| Compound Name | (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate |
| PubChem CID | 174338130 |
| Molecular Formula | C16H19F2N3O5S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate |
| SMILES | CCn1c(COC(N)=O)nc(C(C)C)c1S(=O)(=O)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H19F2N3O5S/c1-4-21-13(8-25-16(19)22)20-14(9(2)3)15(21)27(23,24)26-12-6-10(17)5-11(18)7-12/h5-7,9H,4,8H2,1-3H3,(H2,19,22) |
| InChIKey | JRQYEVIWPQDBTG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate?
The IUPAC name of (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate (CID 174338130) is (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate.
What is the SMILES notation for (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate?
The canonical SMILES for (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate is CCn1c(COC(N)=O)nc(C(C)C)c1S(=O)(=O)Oc1cc(F)cc(F)c1.
What is the InChIKey of (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate?
The InChIKey is JRQYEVIWPQDBTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N3O5S/c1-4-21-13(8-25-16(19)22)20-14(9(2)3)15(21)27(23,24)26-12-6-10(17)5-11(18)7-12/h5-7,9H,4,8H2,1-3H3,(H2,19,22).
What are the key properties of (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate?
(3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate has a molecular weight of 403.41 g/mol, XLogP of 2.67, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl) 2-(carbamoyloxymethyl)-3-ethyl-5-propan-2-ylimidazole-4-sulfonate is sourced from PubChem (CID 174338130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).