C20H22F2N6O3S — CID 174338132
(3,5-difluorophenyl) 2-(1,2-diamino-2-iminoethylidene)-5-propan-2-yl-3-(pyridin-4-ylmethyl)-1H-imidazole-4-sulfonate (PubChem CID 174338132) has the molecular formula C20H22F2N6O3S and a molecular weight of 464.50 g/mol. Its IUPAC name is (3,5-difluorophenyl) 2-(1,2-diamino-2-iminoethylidene)-5-propan-2-yl-3-(pyridin-4-ylmethyl)-1H-imidazole-4-sulfonate.
| Compound Name | (3,5-difluorophenyl) 2-(1,2-diamino-2-iminoethylidene)-5-propan-2-yl-3-(pyridin-4-ylmethyl)-1H-imidazole-4-sulfonate |
|---|---|
| PubChem CID | 174338132 |
| Molecular Formula | C20H22F2N6O3S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (3,5-difluorophenyl) 2-(1,2-diamino-2-iminoethylidene)-5-propan-2-yl-3-(pyridin-4-ylmethyl)-1H-imidazole-4-sulfonate |
| SMILES | [H]/N=C(\N)C(N)=C1NC(C(C)C)=C(S(=O)(=O)Oc2cc(F)cc(F)c2)N1Cc1ccncc1 |
| InChI | InChI=1S/C20H22F2N6O3S/c1-11(2)17-20(32(29,30)31-15-8-13(21)7-14(22)9-15)28(10-12-3-5-26-6-4-12)19(27-17)16(23)18(24)25/h3-9,11,27H,10,23H2,1-2H3,(H3,24,25) |
| InChIKey | QDOSALNQNIEYPQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 147.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|