About ethyl 2,3-dihydroxyhept-6-enoate
ethyl 2,3-dihydroxyhept-6-enoate (PubChem CID 174338396) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is ethyl 2,3-dihydroxyhept-6-enoate.
Molecular Properties
| Compound Name | ethyl 2,3-dihydroxyhept-6-enoate |
| PubChem CID | 174338396 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | ethyl 2,3-dihydroxyhept-6-enoate |
| SMILES | C=CCCC(O)C(O)C(=O)OCC |
| InChI | InChI=1S/C9H16O4/c1-3-5-6-7(10)8(11)9(12)13-4-2/h3,7-8,10-11H,1,4-6H2,2H3 |
| InChIKey | MRWWYRDPZLFAGG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2,3-dihydroxyhept-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dihydroxyhept-6-enoate?
The IUPAC name of ethyl 2,3-dihydroxyhept-6-enoate (CID 174338396) is ethyl 2,3-dihydroxyhept-6-enoate.
What is the SMILES notation for ethyl 2,3-dihydroxyhept-6-enoate?
The canonical SMILES for ethyl 2,3-dihydroxyhept-6-enoate is C=CCCC(O)C(O)C(=O)OCC.
What is the InChIKey of ethyl 2,3-dihydroxyhept-6-enoate?
The InChIKey is MRWWYRDPZLFAGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-3-5-6-7(10)8(11)9(12)13-4-2/h3,7-8,10-11H,1,4-6H2,2H3.
What are the key properties of ethyl 2,3-dihydroxyhept-6-enoate?
ethyl 2,3-dihydroxyhept-6-enoate has a molecular weight of 188.22 g/mol, XLogP of 0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydroxyhept-6-enoate is sourced from PubChem (CID 174338396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).