C11H20N2 — CID 174338503
1,3-dimethyl-2,3,4,5,5a,6,7,8-octahydro-1,2-benzodiazepine (PubChem CID 174338503) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,3-dimethyl-2,3,4,5,5a,6,7,8-octahydro-1,2-benzodiazepine.
| Compound Name | 1,3-dimethyl-2,3,4,5,5a,6,7,8-octahydro-1,2-benzodiazepine |
|---|---|
| PubChem CID | 174338503 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,3-dimethyl-2,3,4,5,5a,6,7,8-octahydro-1,2-benzodiazepine |
| SMILES | CC1CCC2CCCC=C2N(C)N1 |
| InChI | InChI=1S/C11H20N2/c1-9-7-8-10-5-3-4-6-11(10)13(2)12-9/h6,9-10,12H,3-5,7-8H2,1-2H3 |
| InChIKey | UFAMFYAZIRAZRU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |