C9H12IN — CID 174338554
7-iodo-3,4,5,6,7,8-hexahydroisoquinoline (PubChem CID 174338554) has the molecular formula C9H12IN and a molecular weight of 261.11 g/mol. Its IUPAC name is 7-iodo-3,4,5,6,7,8-hexahydroisoquinoline.
| Compound Name | 7-iodo-3,4,5,6,7,8-hexahydroisoquinoline |
|---|---|
| PubChem CID | 174338554 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 7-iodo-3,4,5,6,7,8-hexahydroisoquinoline |
| SMILES | IC1CCC2=C(C=NCC2)C1 |
| InChI | InChI=1S/C9H12IN/c10-9-2-1-7-3-4-11-6-8(7)5-9/h6,9H,1-5H2 |
| InChIKey | VTNSNCXIAFKWJF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|