C34H49BN4O14S — CID 174338686
CID 174338686 (PubChem CID 174338686) has the molecular formula C34H49BN4O14S and a molecular weight of 780.66 g/mol.
| Compound Name | CID 174338686 |
|---|---|
| PubChem CID | 174338686 |
| Molecular Formula | C34H49BN4O14S |
| Molecular Weight | 780.66 g/mol |
| Exact Mass | 780.31 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(OC2CC(OC=O)[C@H](OC(C)=O)C(C(=O)O)O2)c(NC(=O)CCNC(=O)C(CCCCNC(=O)C(C)(C)COC(C)C)NS)c1 |
| InChI | InChI=1S/C34H49BN4O14S/c1-19(2)49-17-34(4,5)32(46)37-12-7-6-8-22(39-54)30(43)36-13-11-26(42)38-23-14-21(16-48-33(35)47)9-10-24(23)52-27-15-25(50-18-40)28(51-20(3)41)29(53-27)31(44)45/h9-10,14,18-19,22,25,27-29,39,54H,6-8,11-13,15-17H2,1-5H3,(H,36,43)(H,37,46)(H,38,42)(H,44,45)/t22?,25?,27?,28-,29?/m0/s1 |
| InChIKey | UMOCVPUXZLKYGH-WYVQKQSCSA-N |
| XLogP | 1.53 |
| TPSA | 243.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|